C19H19NO — CID 144815714
(1Z,3Z)-5-(3,7-dimethyldibenzofuran-4-yl)penta-1,3-dien-1-amine (PubChem CID 144815714) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is (1Z,3Z)-5-(3,7-dimethyldibenzofuran-4-yl)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-5-(3,7-dimethyldibenzofuran-4-yl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 144815714 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (1Z,3Z)-5-(3,7-dimethyldibenzofuran-4-yl)penta-1,3-dien-1-amine |
| SMILES | Cc1ccc2c(c1)oc1c(C/C=C\C=C/N)c(C)ccc12 |
| InChI | InChI=1S/C19H19NO/c1-13-7-9-16-17-10-8-14(2)15(6-4-3-5-11-20)19(17)21-18(16)12-13/h3-5,7-12H,6,20H2,1-2H3/b4-3-,11-5- |
| InChIKey | NXRRUALQRISXSR-RUTRJIIFSA-N |
| XLogP | 4.77 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|