C22H31N — CID 145295437
ethane;(Z)-2-ethyl-1,4-diphenylbut-2-en-1-imine (PubChem CID 145295437) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is ethane;(Z)-2-ethyl-1,4-diphenylbut-2-en-1-imine.
| Compound Name | ethane;(Z)-2-ethyl-1,4-diphenylbut-2-en-1-imine |
|---|---|
| PubChem CID | 145295437 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | ethane;(Z)-2-ethyl-1,4-diphenylbut-2-en-1-imine |
| SMILES | CC.CC.[H]/N=C(C(=C/Cc1ccccc1)\CC)/c1ccccc1 |
| InChI | InChI=1S/C18H19N.2C2H6/c1-2-16(14-13-15-9-5-3-6-10-15)18(19)17-11-7-4-8-12-17;2*1-2/h3-12,14,19H,2,13H2,1H3;2*1-2H3/b16-14-,19-18+;; |
| InChIKey | MNTSPXBOPLGUQM-FSJYQXQGSA-N |
| XLogP | 6.69 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|