C19H24P+ — CID 177487791
[(Z)-2,4-diphenylbut-2-enyl]-trimethylphosphanium (PubChem CID 177487791) has the molecular formula C19H24P+ and a molecular weight of 283.38 g/mol. Its IUPAC name is [(Z)-2,4-diphenylbut-2-enyl]-trimethylphosphanium.
| Compound Name | [(Z)-2,4-diphenylbut-2-enyl]-trimethylphosphanium |
|---|---|
| PubChem CID | 177487791 |
| Molecular Formula | C19H24P+ |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | [(Z)-2,4-diphenylbut-2-enyl]-trimethylphosphanium |
| SMILES | C[P+](C)(C)C/C(=C\Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24P/c1-20(2,3)16-19(18-12-8-5-9-13-18)15-14-17-10-6-4-7-11-17/h4-13,15H,14,16H2,1-3H3/q+1/b19-15+ |
| InChIKey | ROGSODSPPOYBMR-XDJHFCHBSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|