About 1,3-diiminothiourea
1,3-diiminothiourea (PubChem CID 23135884) has the molecular formula CH2N4S
and a molecular weight of 102.12 g/mol. Its IUPAC name is 1,3-diiminothiourea.
Molecular Properties
| Compound Name | 1,3-diiminothiourea |
| PubChem CID | 23135884 |
| Molecular Formula | CH2N4S |
| Molecular Weight | 102.12 g/mol |
| Exact Mass | 102.00 |
| IUPAC Name | 1,3-diiminothiourea |
| SMILES | [H]/N=N/C(=S)/N=N/[H] |
| InChI | InChI=1S/CH2N4S/c2-4-1(6)5-3/h2-3H/b4-2+,5-3+ |
| InChIKey | SAEVNBSIFBBPBI-ZUVMSYQZSA-N |
| XLogP | 1.33 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.12 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diiminothiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diiminothiourea?
The IUPAC name of 1,3-diiminothiourea (CID 23135884) is 1,3-diiminothiourea.
What is the SMILES notation for 1,3-diiminothiourea?
The canonical SMILES for 1,3-diiminothiourea is [H]/N=N/C(=S)/N=N/[H].
What is the InChIKey of 1,3-diiminothiourea?
The InChIKey is SAEVNBSIFBBPBI-ZUVMSYQZSA-N. The full InChI is InChI=1S/CH2N4S/c2-4-1(6)5-3/h2-3H/b4-2+,5-3+.
What are the key properties of 1,3-diiminothiourea?
1,3-diiminothiourea has a molecular weight of 102.12 g/mol, XLogP of 1.33, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diiminothiourea is sourced from PubChem (CID 23135884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).