C2H5N5 — CID 172971684
N'-diazenyl-N-iminoethanimidamide (PubChem CID 172971684) has the molecular formula C2H5N5 and a molecular weight of 99.10 g/mol. Its IUPAC name is N'-diazenyl-N-iminoethanimidamide.
| Compound Name | N'-diazenyl-N-iminoethanimidamide |
|---|---|
| PubChem CID | 172971684 |
| Molecular Formula | C2H5N5 |
| Molecular Weight | 99.10 g/mol |
| Exact Mass | 99.05 |
| IUPAC Name | N'-diazenyl-N-iminoethanimidamide |
| SMILES | [H]/N=N/N=C(C)\N=N\[H] |
| InChI | InChI=1S/C2H5N5/c1-2(5-3)6-7-4/h3-4H,1H3/b5-3+,6-2-,7-4+ |
| InChIKey | BHIRCICRAPBOAR-FNPWYDCCSA-N |
| XLogP | 1.38 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.10 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|