C7H15N5O — CID 140637142
N-[2-(2-aminoethylamino)ethyl]-2-diazenylprop-2-enamide (PubChem CID 140637142) has the molecular formula C7H15N5O and a molecular weight of 185.23 g/mol. Its IUPAC name is N-[2-(2-aminoethylamino)ethyl]-2-diazenylprop-2-enamide.
| Compound Name | N-[2-(2-aminoethylamino)ethyl]-2-diazenylprop-2-enamide |
|---|---|
| PubChem CID | 140637142 |
| Molecular Formula | C7H15N5O |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | N-[2-(2-aminoethylamino)ethyl]-2-diazenylprop-2-enamide |
| SMILES | [H]/N=N/C(=C)C(=O)NCCNCCN |
| InChI | InChI=1S/C7H15N5O/c1-6(12-9)7(13)11-5-4-10-3-2-8/h9-10H,1-5,8H2,(H,11,13)/b12-9+ |
| InChIKey | BORCJUBNLRKEHG-FMIVXFBMSA-N |
| XLogP | -0.80 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|