C16H26ClN — CID 142913118
(2Z)-2-(1-chloroethenyl)-N-[(4-ethylcyclohexyl)methyl]penta-2,4-dien-1-amine (PubChem CID 142913118) has the molecular formula C16H26ClN and a molecular weight of 267.84 g/mol. Its IUPAC name is (2Z)-2-(1-chloroethenyl)-N-[(4-ethylcyclohexyl)methyl]penta-2,4-dien-1-amine.
| Compound Name | (2Z)-2-(1-chloroethenyl)-N-[(4-ethylcyclohexyl)methyl]penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142913118 |
| Molecular Formula | C16H26ClN |
| Molecular Weight | 267.84 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (2Z)-2-(1-chloroethenyl)-N-[(4-ethylcyclohexyl)methyl]penta-2,4-dien-1-amine |
| SMILES | C=C/C=C(/CNCC1CCC(CC)CC1)C(=C)Cl |
| InChI | InChI=1S/C16H26ClN/c1-4-6-16(13(3)17)12-18-11-15-9-7-14(5-2)8-10-15/h4,6,14-15,18H,1,3,5,7-12H2,2H3/b16-6- |
| InChIKey | REVMJUWURRDXSE-SOFYXZRVSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|