C13H20O — CID 123746501
1-ethyl-3-hexa-1,3,5-trien-3-yloxycyclopentane (PubChem CID 123746501) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 1-ethyl-3-hexa-1,3,5-trien-3-yloxycyclopentane.
| Compound Name | 1-ethyl-3-hexa-1,3,5-trien-3-yloxycyclopentane |
|---|---|
| PubChem CID | 123746501 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1-ethyl-3-hexa-1,3,5-trien-3-yloxycyclopentane |
| SMILES | C=CC=C(C=C)OC1CCC(CC)C1 |
| InChI | InChI=1S/C13H20O/c1-4-7-12(6-3)14-13-9-8-11(5-2)10-13/h4,6-7,11,13H,1,3,5,8-10H2,2H3 |
| InChIKey | JATYUTCBPPYQEX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|