C12H21NO — CID 178010614
N-ethyl-3-[(3E)-hexa-1,3,5-trien-3-yl]oxycyclobutan-1-amine;molecular hydrogen (PubChem CID 178010614) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N-ethyl-3-[(3E)-hexa-1,3,5-trien-3-yl]oxycyclobutan-1-amine;molecular hydrogen.
| Compound Name | N-ethyl-3-[(3E)-hexa-1,3,5-trien-3-yl]oxycyclobutan-1-amine;molecular hydrogen |
|---|---|
| PubChem CID | 178010614 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N-ethyl-3-[(3E)-hexa-1,3,5-trien-3-yl]oxycyclobutan-1-amine;molecular hydrogen |
| SMILES | C=C/C=C(\C=C)OC1CC(NCC)C1.[H][H] |
| InChI | InChI=1S/C12H19NO.H2/c1-4-7-11(5-2)14-12-8-10(9-12)13-6-3;/h4-5,7,10,12-13H,1-2,6,8-9H2,3H3;1H/b11-7+; |
| InChIKey | BMHJHPITFLLKIR-RVDQCCQOSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|