C13H29N — CID 144914242
N,3-diethyl-5-methylcyclohexan-1-amine;ethane (PubChem CID 144914242) has the molecular formula C13H29N and a molecular weight of 199.38 g/mol. Its IUPAC name is N,3-diethyl-5-methylcyclohexan-1-amine;ethane.
| Compound Name | N,3-diethyl-5-methylcyclohexan-1-amine;ethane |
|---|---|
| PubChem CID | 144914242 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | N,3-diethyl-5-methylcyclohexan-1-amine;ethane |
| SMILES | CC.CCNC1CC(C)CC(CC)C1 |
| InChI | InChI=1S/C11H23N.C2H6/c1-4-10-6-9(3)7-11(8-10)12-5-2;1-2/h9-12H,4-8H2,1-3H3;1-2H3 |
| InChIKey | JUVYKEGZISTMRA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |