C15H23NO2 — CID 142407732
1-[4-[3-(ethylamino)cyclobutyl]oxyphenyl]propan-2-one;molecular hydrogen (PubChem CID 142407732) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 1-[4-[3-(ethylamino)cyclobutyl]oxyphenyl]propan-2-one;molecular hydrogen.
| Compound Name | 1-[4-[3-(ethylamino)cyclobutyl]oxyphenyl]propan-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 142407732 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-[4-[3-(ethylamino)cyclobutyl]oxyphenyl]propan-2-one;molecular hydrogen |
| SMILES | CCNC1CC(Oc2ccc(CC(C)=O)cc2)C1.[H][H] |
| InChI | InChI=1S/C15H21NO2.H2/c1-3-16-13-9-15(10-13)18-14-6-4-12(5-7-14)8-11(2)17;/h4-7,13,15-16H,3,8-10H2,1-2H3;1H |
| InChIKey | KPIHHPSJGUAEPW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |