C13H22O — CID 143682718
1-ethyl-3-[(2Z,4E)-hepta-2,4-dien-4-yl]oxycyclobutane (PubChem CID 143682718) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-ethyl-3-[(2Z,4E)-hepta-2,4-dien-4-yl]oxycyclobutane.
| Compound Name | 1-ethyl-3-[(2Z,4E)-hepta-2,4-dien-4-yl]oxycyclobutane |
|---|---|
| PubChem CID | 143682718 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 1-ethyl-3-[(2Z,4E)-hepta-2,4-dien-4-yl]oxycyclobutane |
| SMILES | C/C=C\C(=C/CC)OC1CC(CC)C1 |
| InChI | InChI=1S/C13H22O/c1-4-7-12(8-5-2)14-13-9-11(6-3)10-13/h4,7-8,11,13H,5-6,9-10H2,1-3H3/b7-4-,12-8+ |
| InChIKey | IVQKQPRKAUYAFC-OTIJGBKASA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|