C22H42GeO — CID 134905046
triethyl-[(2E,4E)-3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyhexa-2,4-dienyl]germane (PubChem CID 134905046) has the molecular formula C22H42GeO and a molecular weight of 395.19 g/mol. Its IUPAC name is triethyl-[(2E,4E)-3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyhexa-2,4-dienyl]germane.
| Compound Name | triethyl-[(2E,4E)-3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyhexa-2,4-dienyl]germane |
|---|---|
| PubChem CID | 134905046 |
| Molecular Formula | C22H42GeO |
| Molecular Weight | 395.19 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | triethyl-[(2E,4E)-3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxyhexa-2,4-dienyl]germane |
| SMILES | C/C=C/C(=C\C[Ge](CC)(CC)CC)O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C22H42GeO/c1-8-12-20(15-16-23(9-2,10-3)11-4)24-22-17-19(7)13-14-21(22)18(5)6/h8,12,15,18-19,21-22H,9-11,13-14,16-17H2,1-7H3/b12-8+,20-15+/t19-,21+,22-/m0/s1 |
| InChIKey | BWOSOEUREAWTEY-VBXZMAJGSA-N |
| XLogP | 7.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.19 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|