C13H23BrO — CID 11380333
(1S,2R,4R)-2-[(E)-1-bromoprop-1-enoxy]-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 11380333) has the molecular formula C13H23BrO and a molecular weight of 275.23 g/mol. Its IUPAC name is (1S,2R,4R)-2-[(E)-1-bromoprop-1-enoxy]-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1S,2R,4R)-2-[(E)-1-bromoprop-1-enoxy]-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 11380333 |
| Molecular Formula | C13H23BrO |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (1S,2R,4R)-2-[(E)-1-bromoprop-1-enoxy]-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | C/C=C(/Br)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C13H23BrO/c1-5-13(14)15-12-8-10(4)6-7-11(12)9(2)3/h5,9-12H,6-8H2,1-4H3/b13-5-/t10-,11+,12-/m1/s1 |
| InChIKey | MAJLFFXZCBLQTJ-XEKYJEDASA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|