C13H19BrO — CID 155583299
[(3Z,5Z,7E)-7-bromonona-3,5,7-trien-4-yl]oxycyclobutane (PubChem CID 155583299) has the molecular formula C13H19BrO and a molecular weight of 271.20 g/mol. Its IUPAC name is [(3Z,5Z,7E)-7-bromonona-3,5,7-trien-4-yl]oxycyclobutane.
| Compound Name | [(3Z,5Z,7E)-7-bromonona-3,5,7-trien-4-yl]oxycyclobutane |
|---|---|
| PubChem CID | 155583299 |
| Molecular Formula | C13H19BrO |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | [(3Z,5Z,7E)-7-bromonona-3,5,7-trien-4-yl]oxycyclobutane |
| SMILES | C/C=C(Br)\C=C/C(=C/CC)OC1CCC1 |
| InChI | InChI=1S/C13H19BrO/c1-3-6-12(10-9-11(14)4-2)15-13-7-5-8-13/h4,6,9-10,13H,3,5,7-8H2,1-2H3/b10-9-,11-4+,12-6- |
| InChIKey | BZEIICPMSVYGNV-JPYXYJRGSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|