C13H21NO — CID 143594991
[[(3E,5Z)-5-prop-2-enylidenenona-1,3-dien-4-yl]amino]methanol (PubChem CID 143594991) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is [[(3E,5Z)-5-prop-2-enylidenenona-1,3-dien-4-yl]amino]methanol.
| Compound Name | [[(3E,5Z)-5-prop-2-enylidenenona-1,3-dien-4-yl]amino]methanol |
|---|---|
| PubChem CID | 143594991 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | [[(3E,5Z)-5-prop-2-enylidenenona-1,3-dien-4-yl]amino]methanol |
| SMILES | C=C/C=C(CCCC)\C(=C/C=C)NCO |
| InChI | InChI=1S/C13H21NO/c1-4-7-10-12(8-5-2)13(9-6-3)14-11-15/h5-6,8-9,14-15H,2-4,7,10-11H2,1H3/b12-8-,13-9+ |
| InChIKey | MIIPBXVEZQBBHI-QRBCZBMESA-N |
| XLogP | 2.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|