C23H48N2 — CID 169246496
ethane;(E,7Z)-8-N-hexan-3-yl-7-prop-2-enylidenedec-8-ene-1,8-diamine (PubChem CID 169246496) has the molecular formula C23H48N2 and a molecular weight of 352.65 g/mol. Its IUPAC name is ethane;(E,7Z)-8-N-hexan-3-yl-7-prop-2-enylidenedec-8-ene-1,8-diamine.
| Compound Name | ethane;(E,7Z)-8-N-hexan-3-yl-7-prop-2-enylidenedec-8-ene-1,8-diamine |
|---|---|
| PubChem CID | 169246496 |
| Molecular Formula | C23H48N2 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.38 |
| IUPAC Name | ethane;(E,7Z)-8-N-hexan-3-yl-7-prop-2-enylidenedec-8-ene-1,8-diamine |
| SMILES | C=C/C=C(CCCCCCN)\C(=C/C)NC(CC)CCC.CC.CC |
| InChI | InChI=1S/C19H36N2.2C2H6/c1-5-13-17(15-11-9-10-12-16-20)19(8-4)21-18(7-3)14-6-2;2*1-2/h5,8,13,18,21H,1,6-7,9-12,14-16,20H2,2-4H3;2*1-2H3/b17-13-,19-8+;; |
| InChIKey | ULFOCMCPABXHPL-STUQZFJESA-N |
| XLogP | 7.13 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|