C24H50N4O2 — CID 18787747
8-amino-N-[1-(8-aminooctanoylamino)octyl]octanamide (PubChem CID 18787747) has the molecular formula C24H50N4O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is 8-amino-N-[1-(8-aminooctanoylamino)octyl]octanamide.
| Compound Name | 8-amino-N-[1-(8-aminooctanoylamino)octyl]octanamide |
|---|---|
| PubChem CID | 18787747 |
| Molecular Formula | C24H50N4O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | 8-amino-N-[1-(8-aminooctanoylamino)octyl]octanamide |
| SMILES | CCCCCCCC(NC(=O)CCCCCCCN)NC(=O)CCCCCCCN |
| InChI | InChI=1S/C24H50N4O2/c1-2-3-4-7-12-17-22(27-23(29)18-13-8-5-10-15-20-25)28-24(30)19-14-9-6-11-16-21-26/h22H,2-21,25-26H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | RGJLTNBCBGOIEH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|