C17H23N — CID 134257112
N-[(1E,3Z)-2-butyl-3-methylhexa-1,3,5-trienyl]aniline (PubChem CID 134257112) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is N-[(1E,3Z)-2-butyl-3-methylhexa-1,3,5-trienyl]aniline.
| Compound Name | N-[(1E,3Z)-2-butyl-3-methylhexa-1,3,5-trienyl]aniline |
|---|---|
| PubChem CID | 134257112 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-[(1E,3Z)-2-butyl-3-methylhexa-1,3,5-trienyl]aniline |
| SMILES | C=C/C=C(C)\C(=C\Nc1ccccc1)CCCC |
| InChI | InChI=1S/C17H23N/c1-4-6-11-16(15(3)10-5-2)14-18-17-12-8-7-9-13-17/h5,7-10,12-14,18H,2,4,6,11H2,1,3H3/b15-10-,16-14+ |
| InChIKey | OTGXZGMVKHXETH-OPQFGGCESA-N |
| XLogP | 5.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|