C11H18N2 — CID 142083540
(3Z)-N,N-dimethyl-3-prop-1-en-2-ylhexa-3,5-dienimidamide (PubChem CID 142083540) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (3Z)-N,N-dimethyl-3-prop-1-en-2-ylhexa-3,5-dienimidamide.
| Compound Name | (3Z)-N,N-dimethyl-3-prop-1-en-2-ylhexa-3,5-dienimidamide |
|---|---|
| PubChem CID | 142083540 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (3Z)-N,N-dimethyl-3-prop-1-en-2-ylhexa-3,5-dienimidamide |
| SMILES | [H]/N=C(/C/C(=C/C=C)C(=C)C)N(C)C |
| InChI | InChI=1S/C11H18N2/c1-6-7-10(9(2)3)8-11(12)13(4)5/h6-7,12H,1-2,8H2,3-5H3/b10-7-,12-11- |
| InChIKey | WUZLRQYIVRXESE-NEFYYVMFSA-N |
| XLogP | 2.60 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|