C18H40Cl2N4 — CID 24740417
1-N,1-N,14-N,14-N-tetramethyltetradecanediimidamide;dihydrochloride (PubChem CID 24740417) has the molecular formula C18H40Cl2N4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-N,1-N,14-N,14-N-tetramethyltetradecanediimidamide;dihydrochloride.
| Compound Name | 1-N,1-N,14-N,14-N-tetramethyltetradecanediimidamide;dihydrochloride |
|---|---|
| PubChem CID | 24740417 |
| Molecular Formula | C18H40Cl2N4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 1-N,1-N,14-N,14-N-tetramethyltetradecanediimidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(/CCCCCCCCCCCC/C(=N\[H])N(C)C)N(C)C |
| InChI | InChI=1S/C18H38N4.2ClH/c1-21(2)17(19)15-13-11-9-7-5-6-8-10-12-14-16-18(20)22(3)4;;/h19-20H,5-16H2,1-4H3;2*1H/b19-17-,20-18+;; |
| InChIKey | ZCHYZAHYZMULSL-IILAXKDUSA-N |
| XLogP | 5.59 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|