About 4-ethyl-N,N-dimethyloctanimidamide
4-ethyl-N,N-dimethyloctanimidamide (PubChem CID 154330119) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is 4-ethyl-N,N-dimethyloctanimidamide.
Molecular Properties
| Compound Name | 4-ethyl-N,N-dimethyloctanimidamide |
| PubChem CID | 154330119 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 4-ethyl-N,N-dimethyloctanimidamide |
| SMILES | [H]/N=C(/CCC(CC)CCCC)N(C)C |
| InChI | InChI=1S/C12H26N2/c1-5-7-8-11(6-2)9-10-12(13)14(3)4/h11,13H,5-10H2,1-4H3/b13-12- |
| InChIKey | GRXQEZDECBEWBL-SEYXRHQNSA-N |
| XLogP | 3.52 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-N,N-dimethyloctanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N,N-dimethyloctanimidamide?
The IUPAC name of 4-ethyl-N,N-dimethyloctanimidamide (CID 154330119) is 4-ethyl-N,N-dimethyloctanimidamide.
What is the SMILES notation for 4-ethyl-N,N-dimethyloctanimidamide?
The canonical SMILES for 4-ethyl-N,N-dimethyloctanimidamide is [H]/N=C(/CCC(CC)CCCC)N(C)C.
What is the InChIKey of 4-ethyl-N,N-dimethyloctanimidamide?
The InChIKey is GRXQEZDECBEWBL-SEYXRHQNSA-N. The full InChI is InChI=1S/C12H26N2/c1-5-7-8-11(6-2)9-10-12(13)14(3)4/h11,13H,5-10H2,1-4H3/b13-12-.
What are the key properties of 4-ethyl-N,N-dimethyloctanimidamide?
4-ethyl-N,N-dimethyloctanimidamide has a molecular weight of 198.35 g/mol, XLogP of 3.52, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N,N-dimethyloctanimidamide is sourced from PubChem (CID 154330119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).