C14H24N2O — CID 154979097
3-[(3E,5E)-6-ethyl-7-methylocta-3,5,7-trien-3-yl]-1,1-dimethylurea (PubChem CID 154979097) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 3-[(3E,5E)-6-ethyl-7-methylocta-3,5,7-trien-3-yl]-1,1-dimethylurea.
| Compound Name | 3-[(3E,5E)-6-ethyl-7-methylocta-3,5,7-trien-3-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 154979097 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 3-[(3E,5E)-6-ethyl-7-methylocta-3,5,7-trien-3-yl]-1,1-dimethylurea |
| SMILES | C=C(C)/C(=C/C=C(\CC)NC(=O)N(C)C)CC |
| InChI | InChI=1S/C14H24N2O/c1-7-12(11(3)4)9-10-13(8-2)15-14(17)16(5)6/h9-10H,3,7-8H2,1-2,4-6H3,(H,15,17)/b12-9+,13-10+ |
| InChIKey | VJXNUMLOOJFPLA-JOWSBRCASA-N |
| XLogP | 3.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|