C13H23N — CID 142114381
(3E,5Z)-N-but-1-en-2-yl-7-methylocta-3,5-dien-3-amine (PubChem CID 142114381) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (3E,5Z)-N-but-1-en-2-yl-7-methylocta-3,5-dien-3-amine.
| Compound Name | (3E,5Z)-N-but-1-en-2-yl-7-methylocta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 142114381 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (3E,5Z)-N-but-1-en-2-yl-7-methylocta-3,5-dien-3-amine |
| SMILES | C=C(CC)N/C(=C/C=C\C(C)C)CC |
| InChI | InChI=1S/C13H23N/c1-6-12(5)14-13(7-2)10-8-9-11(3)4/h8-11,14H,5-7H2,1-4H3/b9-8-,13-10+ |
| InChIKey | CYQVBFNSHQPZRI-JQHRQWORSA-N |
| XLogP | 4.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|