C9H16N2O3S — CID 134267842
N-[(3E,5E)-6-sulfamoylhepta-3,5-dien-3-yl]acetamide (PubChem CID 134267842) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is N-[(3E,5E)-6-sulfamoylhepta-3,5-dien-3-yl]acetamide.
| Compound Name | N-[(3E,5E)-6-sulfamoylhepta-3,5-dien-3-yl]acetamide |
|---|---|
| PubChem CID | 134267842 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | N-[(3E,5E)-6-sulfamoylhepta-3,5-dien-3-yl]acetamide |
| SMILES | CC/C(=C\C=C(/C)S(N)(=O)=O)NC(C)=O |
| InChI | InChI=1S/C9H16N2O3S/c1-4-9(11-8(3)12)6-5-7(2)15(10,13)14/h5-6H,4H2,1-3H3,(H,11,12)(H2,10,13,14)/b7-5+,9-6+ |
| InChIKey | IBLKLDOMCPQDOF-PDTNFJSOSA-N |
| XLogP | 0.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|