C17H28O3 — CID 89305063
[(3E,5Z)-7-hydroxyhepta-1,3,5-trien-4-yl] 2,3,3-trimethyl-2-propan-2-ylbutanoate (PubChem CID 89305063) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is [(3E,5Z)-7-hydroxyhepta-1,3,5-trien-4-yl] 2,3,3-trimethyl-2-propan-2-ylbutanoate.
| Compound Name | [(3E,5Z)-7-hydroxyhepta-1,3,5-trien-4-yl] 2,3,3-trimethyl-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 89305063 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [(3E,5Z)-7-hydroxyhepta-1,3,5-trien-4-yl] 2,3,3-trimethyl-2-propan-2-ylbutanoate |
| SMILES | C=C/C=C(\C=C/CO)OC(=O)C(C)(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H28O3/c1-8-10-14(11-9-12-18)20-15(19)17(7,13(2)3)16(4,5)6/h8-11,13,18H,1,12H2,2-7H3/b11-9-,14-10+ |
| InChIKey | DHARFYVQEJBISB-JIYPUEFQSA-N |
| XLogP | 3.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|