C12H18O3 — CID 145115556
2-[(3E)-hexa-1,3,5-trien-3-yl]oxypropyl propanoate (PubChem CID 145115556) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]oxypropyl propanoate.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]oxypropyl propanoate |
|---|---|
| PubChem CID | 145115556 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]oxypropyl propanoate |
| SMILES | C=C/C=C(\C=C)OC(C)COC(=O)CC |
| InChI | InChI=1S/C12H18O3/c1-5-8-11(6-2)15-10(4)9-14-12(13)7-3/h5-6,8,10H,1-2,7,9H2,3-4H3/b11-8+ |
| InChIKey | XONCXSNQKYXHCW-DHZHZOJOSA-N |
| XLogP | 2.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|