C18H34O3 — CID 134285877
(3-ethyl-3-hydroxyhex-5-enyl) 2,3,3-trimethyl-2-propan-2-ylbutanoate (PubChem CID 134285877) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is (3-ethyl-3-hydroxyhex-5-enyl) 2,3,3-trimethyl-2-propan-2-ylbutanoate.
| Compound Name | (3-ethyl-3-hydroxyhex-5-enyl) 2,3,3-trimethyl-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 134285877 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | (3-ethyl-3-hydroxyhex-5-enyl) 2,3,3-trimethyl-2-propan-2-ylbutanoate |
| SMILES | C=CCC(O)(CC)CCOC(=O)C(C)(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H34O3/c1-9-11-18(20,10-2)12-13-21-15(19)17(8,14(3)4)16(5,6)7/h9,14,20H,1,10-13H2,2-8H3 |
| InChIKey | WYBOGBCTVXACBI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|