C19H36O3 — CID 166851722
(3-ethyl-3-hydroxyhex-5-enyl) 2-tert-butyl-2,3,3-trimethylbutanoate (PubChem CID 166851722) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is (3-ethyl-3-hydroxyhex-5-enyl) 2-tert-butyl-2,3,3-trimethylbutanoate.
| Compound Name | (3-ethyl-3-hydroxyhex-5-enyl) 2-tert-butyl-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 166851722 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | (3-ethyl-3-hydroxyhex-5-enyl) 2-tert-butyl-2,3,3-trimethylbutanoate |
| SMILES | C=CCC(O)(CC)CCOC(=O)C(C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H36O3/c1-10-12-19(21,11-2)13-14-22-15(20)18(9,16(3,4)5)17(6,7)8/h10,21H,1,11-14H2,2-9H3 |
| InChIKey | RIFVRHLIGJLAEO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|