About 2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate
2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate (PubChem CID 89069139) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate.
Analyze 2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate?
The IUPAC name of 2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate (CID 89069139) is 2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate?
The canonical SMILES for 2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate is CN(C)CCOC(=O)C(C)(C(C)(C)C)C(C)(C)C.
What is the InChIKey of 2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate?
The InChIKey is IOHCKEOCLIPATP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2/c1-13(2,3)15(7,14(4,5)6)12(17)18-11-10-16(8)9/h10-11H2,1-9H3.
What are the key properties of 2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate?
2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate has a molecular weight of 257.42 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-tert-butyl-2,3,3-trimethylbutanoate is sourced from PubChem (CID 89069139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).