C35H67NO6 — CID 146335552
2-O-[2-(dimethylamino)ethyl] 5-O,9-O-dimethyl 2,2,3,4,4,5,5,6,7,7,9,9,10,11-tetradecamethyldodecane-2,5,9-tricarboxylate (PubChem CID 146335552) has the molecular formula C35H67NO6 and a molecular weight of 597.92 g/mol. Its IUPAC name is 2-O-[2-(dimethylamino)ethyl] 5-O,9-O-dimethyl 2,2,3,4,4,5,5,6,7,7,9,9,10,11-tetradecamethyldodecane-2,5,9-tricarboxylate.
| Compound Name | 2-O-[2-(dimethylamino)ethyl] 5-O,9-O-dimethyl 2,2,3,4,4,5,5,6,7,7,9,9,10,11-tetradecamethyldodecane-2,5,9-tricarboxylate |
|---|---|
| PubChem CID | 146335552 |
| Molecular Formula | C35H67NO6 |
| Molecular Weight | 597.92 g/mol |
| Exact Mass | 597.50 |
| IUPAC Name | 2-O-[2-(dimethylamino)ethyl] 5-O,9-O-dimethyl 2,2,3,4,4,5,5,6,7,7,9,9,10,11-tetradecamethyldodecane-2,5,9-tricarboxylate |
| SMILES | COC(=O)C(C)(C(C)C)C(C)(C)CC(C)(C)C(C)(C(=O)OC)C(C)(C)C(C)(C)C(C)(C(=O)OCCN(C)C)C(C)(C)C |
| InChI | InChI=1S/C35H67NO6/c1-24(2)33(14,25(37)40-19)29(6,7)23-30(8,9)35(16,26(38)41-20)32(12,13)31(10,11)34(15,28(3,4)5)27(39)42-22-21-36(17)18/h24H,21-23H2,1-20H3 |
| InChIKey | QGPSOYJUAXOJBY-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.92 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|