C13H26O3 — CID 126765585
2-hydroxyethyl 2-tert-butyl-2,3-dimethylpentanoate (PubChem CID 126765585) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-hydroxyethyl 2-tert-butyl-2,3-dimethylpentanoate.
| Compound Name | 2-hydroxyethyl 2-tert-butyl-2,3-dimethylpentanoate |
|---|---|
| PubChem CID | 126765585 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 2-hydroxyethyl 2-tert-butyl-2,3-dimethylpentanoate |
| SMILES | CCC(C)C(C)(C(=O)OCCO)C(C)(C)C |
| InChI | InChI=1S/C13H26O3/c1-7-10(2)13(6,12(3,4)5)11(15)16-9-8-14/h10,14H,7-9H2,1-6H3 |
| InChIKey | QAADBEVRBQKKGK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |