C16H21N3O — CID 155061302
(3E,5E)-5-[2-[(3E,5E)-5-aminoocta-1,3,5,7-tetraen-4-yl]diaziridin-1-yl]hepta-1,3,5-trien-4-ol (PubChem CID 155061302) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is (3E,5E)-5-[2-[(3E,5E)-5-aminoocta-1,3,5,7-tetraen-4-yl]diaziridin-1-yl]hepta-1,3,5-trien-4-ol.
| Compound Name | (3E,5E)-5-[2-[(3E,5E)-5-aminoocta-1,3,5,7-tetraen-4-yl]diaziridin-1-yl]hepta-1,3,5-trien-4-ol |
|---|---|
| PubChem CID | 155061302 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (3E,5E)-5-[2-[(3E,5E)-5-aminoocta-1,3,5,7-tetraen-4-yl]diaziridin-1-yl]hepta-1,3,5-trien-4-ol |
| SMILES | C=C/C=C(N)\C(=C/C=C)N1CN1C(=C/C)/C(O)=C\C=C |
| InChI | InChI=1S/C16H21N3O/c1-5-9-13(17)15(10-6-2)19-12-18(19)14(8-4)16(20)11-7-3/h5-11,20H,1-3,12,17H2,4H3/b13-9+,14-8+,15-10+,16-11+ |
| InChIKey | AFFVSWPWGLKNEV-RYYOWAPQSA-N |
| XLogP | 3.11 |
| TPSA | 52.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|