About N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide
N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide (PubChem CID 142712823) has the molecular formula C10H9NO3
and a molecular weight of 191.19 g/mol. Its IUPAC name is N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide.
Molecular Properties
| Compound Name | N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide |
| PubChem CID | 142712823 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide |
| SMILES | C=CC(=O)C(=CC(=O)N=C)C(=O)C=C |
| InChI | InChI=1S/C10H9NO3/c1-4-8(12)7(9(13)5-2)6-10(14)11-3/h4-6H,1-3H2 |
| InChIKey | NLVOGJDSHDSUGN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide?
The IUPAC name of N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide (CID 142712823) is N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide.
What is the SMILES notation for N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide?
The canonical SMILES for N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide is C=CC(=O)C(=CC(=O)N=C)C(=O)C=C.
What is the InChIKey of N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide?
The InChIKey is NLVOGJDSHDSUGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c1-4-8(12)7(9(13)5-2)6-10(14)11-3/h4-6H,1-3H2.
What are the key properties of N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide?
N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide has a molecular weight of 191.19 g/mol, XLogP of 0.65, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylidene-4-oxo-3-prop-2-enoylhexa-2,5-dienamide is sourced from PubChem (CID 142712823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).