About sodium;acetic acid;prop-2-enoic acid
sodium;acetic acid;prop-2-enoic acid (PubChem CID 157405919) has the molecular formula C5H7NaO4
and a molecular weight of 154.10 g/mol. Its IUPAC name is sodium;acetic acid;prop-2-enoic acid.
Molecular Properties
| Compound Name | sodium;acetic acid;prop-2-enoic acid |
| PubChem CID | 157405919 |
| Molecular Formula | C5H7NaO4 |
| Molecular Weight | 154.10 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | sodium;acetic acid;prop-2-enoic acid |
| SMILES | C=CC(=O)O.[CH2-]C(=O)O.[Na+] |
| InChI | InChI=1S/C3H4O2.C2H3O2.Na/c1-2-3(4)5;1-2(3)4;/h2H,1H2,(H,4,5);1H2,(H,3,4);/q;-1;+1 |
| InChIKey | DGJOTDZNTKXGEO-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.10 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;acetic acid;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;acetic acid;prop-2-enoic acid?
The IUPAC name of sodium;acetic acid;prop-2-enoic acid (CID 157405919) is sodium;acetic acid;prop-2-enoic acid.
What is the SMILES notation for sodium;acetic acid;prop-2-enoic acid?
The canonical SMILES for sodium;acetic acid;prop-2-enoic acid is C=CC(=O)O.[CH2-]C(=O)O.[Na+].
What is the InChIKey of sodium;acetic acid;prop-2-enoic acid?
The InChIKey is DGJOTDZNTKXGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.C2H3O2.Na/c1-2-3(4)5;1-2(3)4;/h2H,1H2,(H,4,5);1H2,(H,3,4);/q;-1;+1.
What are the key properties of sodium;acetic acid;prop-2-enoic acid?
sodium;acetic acid;prop-2-enoic acid has a molecular weight of 154.10 g/mol, XLogP of -2.83, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;acetic acid;prop-2-enoic acid is sourced from PubChem (CID 157405919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).