C8H9BrN2O — CID 169108486
N-[(1Z)-3-bromo-1-(methylideneamino)buta-1,3-dienyl]prop-2-enamide (PubChem CID 169108486) has the molecular formula C8H9BrN2O and a molecular weight of 229.08 g/mol. Its IUPAC name is N-[(1Z)-3-bromo-1-(methylideneamino)buta-1,3-dienyl]prop-2-enamide.
| Compound Name | N-[(1Z)-3-bromo-1-(methylideneamino)buta-1,3-dienyl]prop-2-enamide |
|---|---|
| PubChem CID | 169108486 |
| Molecular Formula | C8H9BrN2O |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | N-[(1Z)-3-bromo-1-(methylideneamino)buta-1,3-dienyl]prop-2-enamide |
| SMILES | C=CC(=O)N/C(=C/C(=C)Br)N=C |
| InChI | InChI=1S/C8H9BrN2O/c1-4-8(12)11-7(10-3)5-6(2)9/h4-5H,1-3H2,(H,11,12)/b7-5+ |
| InChIKey | VWAWAJAWRWZREO-FNORWQNLSA-N |
| XLogP | 1.74 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|