C6H6BrKO — CID 144769155
potassium (3E)-5-bromohexa-1,3,5-trien-3-olate (PubChem CID 144769155) has the molecular formula C6H6BrKO and a molecular weight of 213.11 g/mol. Its IUPAC name is potassium (3E)-5-bromohexa-1,3,5-trien-3-olate.
| Compound Name | potassium (3E)-5-bromohexa-1,3,5-trien-3-olate |
|---|---|
| PubChem CID | 144769155 |
| Molecular Formula | C6H6BrKO |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 211.92 |
| IUPAC Name | potassium (3E)-5-bromohexa-1,3,5-trien-3-olate |
| SMILES | C=C/C([O-])=C\C(=C)Br.[K+] |
| InChI | InChI=1S/C6H7BrO.K/c1-3-6(8)4-5(2)7;/h3-4,8H,1-2H2;/q;+1/p-1/b6-4+; |
| InChIKey | SIWNDZIPIXXYGU-CVDVRWGVSA-M |
| XLogP | -1.67 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|