C11H15NO2 — CID 145306776
N-[(3E,5E)-5-hydroxy-2-methylhepta-1,3,5-trien-3-yl]prop-2-enamide (PubChem CID 145306776) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-[(3E,5E)-5-hydroxy-2-methylhepta-1,3,5-trien-3-yl]prop-2-enamide.
| Compound Name | N-[(3E,5E)-5-hydroxy-2-methylhepta-1,3,5-trien-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 145306776 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-[(3E,5E)-5-hydroxy-2-methylhepta-1,3,5-trien-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N/C(=C/C(O)=C\C)C(=C)C |
| InChI | InChI=1S/C11H15NO2/c1-5-9(13)7-10(8(3)4)12-11(14)6-2/h5-7,13H,2-3H2,1,4H3,(H,12,14)/b9-5+,10-7+ |
| InChIKey | VNYDGWZASSAMLE-FWMCCXIMSA-N |
| XLogP | 2.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|