About (methylideneamino) prop-2-enoate
(methylideneamino) prop-2-enoate (PubChem CID 141313735) has the molecular formula C4H5NO2
and a molecular weight of 99.09 g/mol. Its IUPAC name is (methylideneamino) prop-2-enoate.
Molecular Properties
| Compound Name | (methylideneamino) prop-2-enoate |
| PubChem CID | 141313735 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | (methylideneamino) prop-2-enoate |
| SMILES | C=CC(=O)ON=C |
| InChI | InChI=1S/C4H5NO2/c1-3-4(6)7-5-2/h3H,1-2H2 |
| InChIKey | ATBWCMQSWILTDT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (methylideneamino) prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (methylideneamino) prop-2-enoate?
The IUPAC name of (methylideneamino) prop-2-enoate (CID 141313735) is (methylideneamino) prop-2-enoate.
What is the SMILES notation for (methylideneamino) prop-2-enoate?
The canonical SMILES for (methylideneamino) prop-2-enoate is C=CC(=O)ON=C.
What is the InChIKey of (methylideneamino) prop-2-enoate?
The InChIKey is ATBWCMQSWILTDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2/c1-3-4(6)7-5-2/h3H,1-2H2.
What are the key properties of (methylideneamino) prop-2-enoate?
(methylideneamino) prop-2-enoate has a molecular weight of 99.09 g/mol, XLogP of 0.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (methylideneamino) prop-2-enoate is sourced from PubChem (CID 141313735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).