C10H14O3 — CID 88884719
(2E,4Z)-2-(hydroxymethyl)-6-methoxy-4-methylhepta-2,4,6-trienal (PubChem CID 88884719) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (2E,4Z)-2-(hydroxymethyl)-6-methoxy-4-methylhepta-2,4,6-trienal.
| Compound Name | (2E,4Z)-2-(hydroxymethyl)-6-methoxy-4-methylhepta-2,4,6-trienal |
|---|---|
| PubChem CID | 88884719 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (2E,4Z)-2-(hydroxymethyl)-6-methoxy-4-methylhepta-2,4,6-trienal |
| SMILES | C=C(/C=C(C)\C=C(\C=O)CO)OC |
| InChI | InChI=1S/C10H14O3/c1-8(4-9(2)13-3)5-10(6-11)7-12/h4-6,12H,2,7H2,1,3H3/b8-4-,10-5- |
| InChIKey | OEDUONPOMFQBDT-AKVKBJFPSA-N |
| XLogP | 1.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|