C23H48O2Si2 — CID 102163574
[3-methyl-1-tri(propan-2-yl)silyloxybuta-1,3-dienoxy]-tri(propan-2-yl)silane (PubChem CID 102163574) has the molecular formula C23H48O2Si2 and a molecular weight of 412.81 g/mol. Its IUPAC name is [3-methyl-1-tri(propan-2-yl)silyloxybuta-1,3-dienoxy]-tri(propan-2-yl)silane.
| Compound Name | [3-methyl-1-tri(propan-2-yl)silyloxybuta-1,3-dienoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102163574 |
| Molecular Formula | C23H48O2Si2 |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | [3-methyl-1-tri(propan-2-yl)silyloxybuta-1,3-dienoxy]-tri(propan-2-yl)silane |
| SMILES | C=C(C)C=C(O[Si](C(C)C)(C(C)C)C(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H48O2Si2/c1-16(2)15-23(24-26(17(3)4,18(5)6)19(7)8)25-27(20(9)10,21(11)12)22(13)14/h15,17-22H,1H2,2-14H3 |
| InChIKey | LFOARGWCWYQGEG-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|