C22H40O3Si — CID 11058013
[(3E,5E)-6-(2,2-dimethyl-1,3-dioxan-5-yl)-3-methylhexa-1,3,5-trien-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 11058013) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is [(3E,5E)-6-(2,2-dimethyl-1,3-dioxan-5-yl)-3-methylhexa-1,3,5-trien-2-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3E,5E)-6-(2,2-dimethyl-1,3-dioxan-5-yl)-3-methylhexa-1,3,5-trien-2-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11058013 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | [(3E,5E)-6-(2,2-dimethyl-1,3-dioxan-5-yl)-3-methylhexa-1,3,5-trien-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C=C(O[Si](C(C)C)(C(C)C)C(C)C)/C(C)=C/C=C/C1COC(C)(C)OC1 |
| InChI | InChI=1S/C22H40O3Si/c1-16(2)26(17(3)4,18(5)6)25-20(8)19(7)12-11-13-21-14-23-22(9,10)24-15-21/h11-13,16-18,21H,8,14-15H2,1-7,9-10H3/b13-11+,19-12+ |
| InChIKey | ASALEIMFDFHRSY-SZFRVYISSA-N |
| XLogP | 6.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|