C7H14O3 — CID 59156430
5-methoxy-2,2-dimethyl-1,3-dioxane (PubChem CID 59156430) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is 5-methoxy-2,2-dimethyl-1,3-dioxane.
| Compound Name | 5-methoxy-2,2-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 59156430 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 5-methoxy-2,2-dimethyl-1,3-dioxane |
| SMILES | COC1COC(C)(C)OC1 |
| InChI | InChI=1S/C7H14O3/c1-7(2)9-4-6(8-3)5-10-7/h6H,4-5H2,1-3H3 |
| InChIKey | FDMUPLSSJLNYPH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |