C17H32O3Si — CID 132576243
tert-butyl-[(1Z,3E)-1-(2,2-dimethyl-1,3-dioxan-5-yl)penta-1,3-dien-2-yl]oxy-dimethylsilane (PubChem CID 132576243) has the molecular formula C17H32O3Si and a molecular weight of 312.53 g/mol. Its IUPAC name is tert-butyl-[(1Z,3E)-1-(2,2-dimethyl-1,3-dioxan-5-yl)penta-1,3-dien-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1Z,3E)-1-(2,2-dimethyl-1,3-dioxan-5-yl)penta-1,3-dien-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 132576243 |
| Molecular Formula | C17H32O3Si |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | tert-butyl-[(1Z,3E)-1-(2,2-dimethyl-1,3-dioxan-5-yl)penta-1,3-dien-2-yl]oxy-dimethylsilane |
| SMILES | C/C=C/C(=C/C1COC(C)(C)OC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O3Si/c1-9-10-15(20-21(7,8)16(2,3)4)11-14-12-18-17(5,6)19-13-14/h9-11,14H,12-13H2,1-8H3/b10-9+,15-11- |
| InChIKey | OMMCYGXCSXCNLR-RKVFCIRRSA-N |
| XLogP | 4.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|