C13H22N2O — CID 155715245
N,N-dimethyl-2-[(3E)-6-methyl-5-methyliminohepta-1,3,6-trien-3-yl]oxyethanamine (PubChem CID 155715245) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N,N-dimethyl-2-[(3E)-6-methyl-5-methyliminohepta-1,3,6-trien-3-yl]oxyethanamine.
| Compound Name | N,N-dimethyl-2-[(3E)-6-methyl-5-methyliminohepta-1,3,6-trien-3-yl]oxyethanamine |
|---|---|
| PubChem CID | 155715245 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N,N-dimethyl-2-[(3E)-6-methyl-5-methyliminohepta-1,3,6-trien-3-yl]oxyethanamine |
| SMILES | C=C/C(=C\C(=N\C)C(=C)C)OCCN(C)C |
| InChI | InChI=1S/C13H22N2O/c1-7-12(16-9-8-15(5)6)10-13(14-4)11(2)3/h7,10H,1-2,8-9H2,3-6H3/b12-10+,14-13- |
| InChIKey | RUVSWIYFUYSMHX-FJDRKQEFSA-N |
| XLogP | 2.28 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|