C27H33NO — CID 118983500
N,N-dimethyl-2-[(3E,5E,7E)-6-methyl-7,8-diphenyldeca-1,3,5,7-tetraen-3-yl]oxyethanamine (PubChem CID 118983500) has the molecular formula C27H33NO and a molecular weight of 387.57 g/mol. Its IUPAC name is N,N-dimethyl-2-[(3E,5E,7E)-6-methyl-7,8-diphenyldeca-1,3,5,7-tetraen-3-yl]oxyethanamine.
| Compound Name | N,N-dimethyl-2-[(3E,5E,7E)-6-methyl-7,8-diphenyldeca-1,3,5,7-tetraen-3-yl]oxyethanamine |
|---|---|
| PubChem CID | 118983500 |
| Molecular Formula | C27H33NO |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | N,N-dimethyl-2-[(3E,5E,7E)-6-methyl-7,8-diphenyldeca-1,3,5,7-tetraen-3-yl]oxyethanamine |
| SMILES | C=C/C(=C\C=C(C)\C(=C(\CC)c1ccccc1)c1ccccc1)OCCN(C)C |
| InChI | InChI=1S/C27H33NO/c1-6-25(29-21-20-28(4)5)19-18-22(3)27(24-16-12-9-13-17-24)26(7-2)23-14-10-8-11-15-23/h6,8-19H,1,7,20-21H2,2-5H3/b22-18+,25-19+,27-26+ |
| InChIKey | BQHCAITXEAUBCM-DAENMUBUSA-N |
| XLogP | 6.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|