C15H23NO3 — CID 142409370
(2E,4Z)-5-[2-(dimethylamino)ethoxy]-4-ethenyl-7-methylocta-2,4,6-trienoic acid (PubChem CID 142409370) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (2E,4Z)-5-[2-(dimethylamino)ethoxy]-4-ethenyl-7-methylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4Z)-5-[2-(dimethylamino)ethoxy]-4-ethenyl-7-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 142409370 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (2E,4Z)-5-[2-(dimethylamino)ethoxy]-4-ethenyl-7-methylocta-2,4,6-trienoic acid |
| SMILES | C=CC(/C=C/C(=O)O)=C(\C=C(C)C)OCCN(C)C |
| InChI | InChI=1S/C15H23NO3/c1-6-13(7-8-15(17)18)14(11-12(2)3)19-10-9-16(4)5/h6-8,11H,1,9-10H2,2-5H3,(H,17,18)/b8-7+,14-13- |
| InChIKey | NLACIRCCENJWHV-YFGOPRLYSA-N |
| XLogP | 2.61 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|