C7H8F2O2S — CID 134449047
(1E,3E)-1,5-difluoro-3-methylsulfonylhexa-1,3,5-triene (PubChem CID 134449047) has the molecular formula C7H8F2O2S and a molecular weight of 194.20 g/mol. Its IUPAC name is (1E,3E)-1,5-difluoro-3-methylsulfonylhexa-1,3,5-triene.
| Compound Name | (1E,3E)-1,5-difluoro-3-methylsulfonylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 134449047 |
| Molecular Formula | C7H8F2O2S |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | (1E,3E)-1,5-difluoro-3-methylsulfonylhexa-1,3,5-triene |
| SMILES | C=C(F)/C=C(\C=C\F)S(C)(=O)=O |
| InChI | InChI=1S/C7H8F2O2S/c1-6(9)5-7(3-4-8)12(2,10)11/h3-5H,1H2,2H3/b4-3+,7-5+ |
| InChIKey | AJKISLVWIWITHT-BDWKERMESA-N |
| XLogP | 1.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|