C6H8F2 — CID 142010106
(1E)-1,3-difluoro-4-methylpenta-1,3-diene (PubChem CID 142010106) has the molecular formula C6H8F2 and a molecular weight of 118.13 g/mol. Its IUPAC name is (1E)-1,3-difluoro-4-methylpenta-1,3-diene.
| Compound Name | (1E)-1,3-difluoro-4-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 142010106 |
| Molecular Formula | C6H8F2 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | (1E)-1,3-difluoro-4-methylpenta-1,3-diene |
| SMILES | CC(C)=C(F)/C=C/F |
| InChI | InChI=1S/C6H8F2/c1-5(2)6(8)3-4-7/h3-4H,1-2H3/b4-3+ |
| InChIKey | HWNQBWQLIQOOLE-ONEGZZNKSA-N |
| XLogP | 2.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|