C9H14F2 — CID 143497549
(4Z,6R)-3,6-difluoro-2-methylocta-2,4-diene (PubChem CID 143497549) has the molecular formula C9H14F2 and a molecular weight of 160.21 g/mol. Its IUPAC name is (4Z,6R)-3,6-difluoro-2-methylocta-2,4-diene.
| Compound Name | (4Z,6R)-3,6-difluoro-2-methylocta-2,4-diene |
|---|---|
| PubChem CID | 143497549 |
| Molecular Formula | C9H14F2 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (4Z,6R)-3,6-difluoro-2-methylocta-2,4-diene |
| SMILES | CC[C@@H](F)/C=C\C(F)=C(C)C |
| InChI | InChI=1S/C9H14F2/c1-4-8(10)5-6-9(11)7(2)3/h5-6,8H,4H2,1-3H3/b6-5-/t8-/m1/s1 |
| InChIKey | VFRJZCZTGUINEK-RPSMYOMKSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|